![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[VID]](/icons/movie.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| the_unfortunate_spec..> | 2017-09-14 17:01 | 149M | |
| sos2005/ | 2017-09-14 19:28 | - | |
| creationfile/ | 2017-09-14 17:42 | - | |
| compressed student w..> | 2017-09-14 18:17 | - | |
| Splash Vid/ | 2017-09-14 19:28 | - | |
| Ruth Files/ | 2017-09-14 18:34 | - | |
| Misc. Tapes of SOS 2..> | 2017-09-14 18:31 | - | |
| MAS final2009/ | 2017-09-14 19:15 | - | |
| Loie_Reel/ | 2017-09-15 07:46 | - | |
| Eat the Sun/ | 2017-09-14 18:50 | - | |
| Eat and Periphery ex..> | 2017-09-14 17:45 | - | |
| EVHA MW 2007-08/ | 2017-09-14 19:09 | - | |
| EVAH MW 05-06/ | 2017-09-14 19:01 | - | |
| C.A.T/ | 2017-09-14 18:17 | - | |
| Animated VisionsA..> | 2017-09-14 18:11 | - | |
| 16 mm Archival Trans..> | 2017-09-14 18:43 | - | |