![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Alice Douglas.tif | 2017-09-15 07:51 | 3.9M | |
| Ballet.tif | 2017-09-15 07:51 | 4.0M | |
| Biology.tif | 2017-09-15 07:51 | 4.0M | |
| Clocktower.tif | 2017-09-15 07:51 | 3.9M | |
| Conference.tif | 2017-09-15 07:51 | 2.3M | |
| Compass.tif | 2017-09-15 07:51 | 9.0M | |
| Debbie Robinson.tif | 2017-09-15 07:51 | 3.9M | |
| FIlm Splicing.tif | 2017-09-15 07:51 | 3.9M | |
| Don Humphrey and Pro..> | 2017-09-15 07:51 | 9.3M | |
| hpothb07.dat | 2017-09-15 07:51 | 3.3K | |
| hpothb07.tif | 2017-09-15 07:51 | 329K | |
| Group.tif | 2017-09-15 07:51 | 3.9M | |
| In the Woods.tif | 2017-09-15 07:51 | 4.0M | |
| Judith Espinola 2.tif | 2017-09-15 07:51 | 3.3M | |
| Judith Espinola 3.tif | 2017-09-15 07:51 | 3.2M | |
| Judith Espinola.tif | 2017-09-15 07:51 | 3.4M | |
| Lighting Tower 2.tif | 2017-09-15 07:51 | 3.2M | |
| Lighting Tower 3.tif | 2017-09-15 07:51 | 3.2M | |
| Lighting Tower.tif | 2017-09-15 07:51 | 3.2M | |
| Mary Huston.tif | 2017-09-15 07:51 | 3.9M | |
| Maxine Mimms.tif | 2017-09-15 07:51 | 10M | |
| Raul Huerta.tif | 2017-09-15 07:51 | 3.9M | |
| Stilson--Enriquez--G..> | 2017-09-15 07:51 | 3.9M | |
| Thelma, Louise, and...> | 2017-09-15 07:51 | 9.0M | |
| Thumbs.db | 2017-09-15 07:51 | 6.0K | |
| Three Men Meeting.tif | 2017-09-15 07:51 | 3.9M | |
| Waves, Particles, an..> | 2017-09-15 07:51 | 9.0M | |
| Willhelm--Fuller--Da..> | 2017-09-15 07:51 | 9.0M | |
| Wooden Structure.tif | 2017-09-15 07:51 | 8.1M | |