![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| A Dorm.tif | 2017-09-15 07:59 | 3.9M | |
| A Dorm 2.tif | 2017-09-15 07:59 | 8.6M | |
| A Dorm Above the Tre..> | 2017-09-15 07:59 | 8.8M | |
| A Dorm Balcony.tif | 2017-09-15 07:59 | 9.1M | |
| A Dorm Billiards.tif | 2017-09-15 07:59 | 3.9M | |
| A Dorm Lobby.tif | 2017-09-15 07:59 | 3.9M | |
| Artist Rendetion of ..> | 2017-09-15 07:59 | 8.9M | |
| Atop of A Dorm.tif | 2017-09-15 07:59 | 4.0M | |
| B Dorm.tif | 2017-09-15 07:59 | 3.9M | |
| B Dorm 2.tif | 2017-09-15 07:59 | 3.9M | |
| Cafe.tif | 2017-09-15 07:59 | 3.9M | |
| Cleared Plot for Dor..> | 2017-09-15 07:59 | 9.0M | |
| Consruction 13.tif | 2017-09-15 07:59 | 9.1M | |
| Construction.tif | 2017-09-15 07:59 | 9.0M | |
| Construction 2.tif | 2017-09-15 07:59 | 9.2M | |
| Construction 3.tif | 2017-09-15 07:59 | 9.1M | |
| Construction 4.tif | 2017-09-15 07:59 | 9.1M | |
| Construction 5.tif | 2017-09-15 07:59 | 9.1M | |
| Construction 6.tif | 2017-09-15 07:59 | 9.1M | |
| Construction 7.tif | 2017-09-15 07:59 | 9.1M | |
| Construction 8.tif | 2017-09-15 07:59 | 9.1M | |
| Construction 9.tif | 2017-09-15 07:59 | 9.1M | |
| Construction 10.tif | 2017-09-15 07:59 | 9.1M | |
| Construction 11.tif | 2017-09-15 07:59 | 9.1M | |
| Construction 12.tif | 2017-09-15 07:59 | 9.1M | |
| Construction 14.tif | 2017-09-15 07:59 | 9.2M | |
| Construction 15.tif | 2017-09-15 07:59 | 9.1M | |
| Construction of Dorm..> | 2017-09-15 07:59 | 9.0M | |
| D Dorm.tif | 2017-09-15 07:59 | 3.9M | |
| Dorm Bench.tif | 2017-09-15 07:59 | 8.9M | |
| Dorm Bridge.tif | 2017-09-15 07:59 | 4.0M | |
| Dorm Bridge 2.tif | 2017-09-15 07:59 | 3.9M | |
| Dorm Bridge 3.tif | 2017-09-15 07:59 | 9.2M | |
| Dorm Construction 1.tif | 2017-09-15 07:59 | 7.7M | |
| Dorm Construction 2.tif | 2017-09-15 07:59 | 9.0M | |
| Dorm Construction 3.tif | 2017-09-15 07:59 | 9.1M | |
| Dorm Construction 4.tif | 2017-09-15 07:59 | 9.1M | |
| Dorm Construction 5.tif | 2017-09-15 07:59 | 9.3M | |
| Dorm Construction 6.tif | 2017-09-15 07:59 | 9.1M | |
| Dorm Construction 7.tif | 2017-09-15 07:59 | 9.3M | |
| Dorm Construction 9.tif | 2017-09-15 07:59 | 9.2M | |
| Dorm Construction 10..> | 2017-09-15 07:59 | 9.2M | |
| Dorm Construction 11..> | 2017-09-15 07:59 | 9.1M | |
| Dorm Construction 12..> | 2017-09-15 07:59 | 9.1M | |
| Dorm Construction 13..> | 2017-09-15 07:59 | 9.1M | |
| Dorm Construction 14..> | 2017-09-15 07:59 | 9.1M | |
| Dorm Construction 15..> | 2017-09-15 07:59 | 9.2M | |
| Dorm Construction 16..> | 2017-09-15 07:59 | 9.1M | |
| Dorm Construction 17..> | 2017-09-15 07:59 | 9.1M | |
| Dorm Construction 18..> | 2017-09-15 07:59 | 7.8M | |
| Dorm Construction 19..> | 2017-09-15 07:59 | 9.1M | |
| Dorm Construction 20..> | 2017-09-15 07:59 | 9.3M | |
| Dorm Constrution 8.tif | 2017-09-15 07:59 | 7.5M | |
| Dorm Courtyard.tif | 2017-09-15 07:59 | 3.9M | |
| Dorm Desk.tif | 2017-09-15 07:59 | 3.9M | |
| Dorm Living Room.tif | 2017-09-15 07:59 | 3.9M | |
| Dorm Models.tif | 2017-09-15 07:59 | 8.9M | |
| Dorm Models 2.tif | 2017-09-15 07:59 | 9.0M | |
| Dorm Room.tif | 2017-09-15 07:59 | 3.9M | |
| Dorms in Color.tif | 2017-09-15 07:59 | 9.0M | |
| Dorm through Trees.tif | 2017-09-15 07:59 | 8.8M | |
| Fresco in A Dorm.tif | 2017-09-15 07:59 | 8.9M | |
| Hazy Dorms.tif | 2017-09-15 07:59 | 3.9M | |
| Illusion.tif | 2017-09-15 07:59 | 9.0M | |
| Land Plot 1.tif | 2017-09-15 07:59 | 9.1M | |
| Land Plot 2.tif | 2017-09-15 07:59 | 9.0M | |
| Looking Up At A Dorm..> | 2017-09-15 07:59 | 9.2M | |
| Looking up at B.tif | 2017-09-15 07:59 | 3.9M | |
| Modular Housing.tif | 2017-09-15 07:59 | 3.9M | |
| Original Plans.tif | 2017-09-15 07:59 | 8.9M | |
| Original Plans 2.tif | 2017-09-15 07:59 | 8.9M | |
| Original Plans 3.tif | 2017-09-15 07:59 | 9.9M | |
| Original Plans 4.tif | 2017-09-15 07:59 | 8.9M | |
| Residence Hall A.tif | 2017-09-15 07:59 | 3.9M | |
| Residence Hall C.tif | 2017-09-15 07:59 | 8.9M | |
| Resting in Dorm Cour..> | 2017-09-15 07:59 | 3.8M | |
| Room Layout 1.tif | 2017-09-15 07:59 | 6.0M | |
| Room Layout 2.tif | 2017-09-15 07:59 | 8.9M | |
| Room Layout 3.tif | 2017-09-15 07:59 | 9.8M | |
| Snowy Campus.tif | 2017-09-15 07:59 | 9.0M | |
| Structure Complete.tif | 2017-09-15 07:59 | 9.1M | |
| Structure Complete 2..> | 2017-09-15 07:59 | 9.1M | |
| Structure Complete 3..> | 2017-09-15 07:59 | 9.1M | |
| Structure Complete 4..> | 2017-09-15 07:59 | 9.2M | |
| Student in Front of ..> | 2017-09-15 07:59 | 9.3M | |
| Sunbathing.tif | 2017-09-15 07:59 | 3.9M | |
| Three-Person Dorm.tif | 2017-09-15 07:59 | 3.9M | |
| Three-Person Dorm 2.tif | 2017-09-15 07:59 | 3.9M | |
| Walking From A.tif | 2017-09-15 07:59 | 3.9M | |
| Walking From A 3.tif | 2017-09-15 07:59 | 7.4M | |
| Walking From A II.tif | 2017-09-15 07:59 | 3.9M | |
| Walking Into D.tif | 2017-09-15 07:59 | 4.0M | |
| hpothb07.dat | 2017-09-15 07:59 | 17K | |
| hpothb07.tif | 2017-09-15 07:59 | 3.1M | |