![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Al Saari.tif | 2017-09-15 07:54 | 1.3M | |
| Al Saari 2.tif | 2017-09-15 07:54 | 2.0M | |
| Andrea Winship and L..> | 2017-09-15 07:54 | 1.9M | |
| Anne Ellsworth.tif | 2017-09-15 07:54 | 1.0M | |
| Anne Shepard.tif | 2017-09-15 07:54 | 961K | |
| Antokol-Hebert-Edwar..> | 2017-09-15 07:54 | 3.9M | |
| Becky Hester.tif | 2017-09-15 07:54 | 2.1M | |
| Brian Gersheim.tif | 2017-09-15 07:54 | 1.0M | |
| Caryn Cline.tif | 2017-09-15 07:54 | 1.0M | |
| Chas Davies.tif | 2017-09-15 07:54 | 1.4M | |
| Christmas Party 1971..> | 2017-09-15 07:54 | 1.9M | |
| Christmas Party 1971..> | 2017-09-15 07:54 | 1.9M | |
| Christmas Party 1971..> | 2017-09-15 07:54 | 1.9M | |
| Circulation Assistan..> | 2017-09-15 07:54 | 450K | |
| Circulation Staff 19..> | 2017-09-15 07:54 | 3.9M | |
| Dave Carnahan.tif | 2017-09-15 07:54 | 510K | |
| Debbie Robinson.tif | 2017-09-15 07:54 | 2.0M | |
| Dick Fuller.tif | 2017-09-15 07:54 | 1.4M | |
| Dick Fuller 2.tif | 2017-09-15 07:54 | 2.0M | |
| Eickholt and Espinoz..> | 2017-09-15 07:54 | 4.0M | |
| Eileen Meconi.tif | 2017-09-15 07:54 | 2.0M | |
| Enriquez- Gersheim- ..> | 2017-09-15 07:54 | 3.9M | |
| Erlene Zaugg.tif | 2017-09-15 07:54 | 2.0M | |
| Ernestine Kimbro.tif | 2017-09-15 07:54 | 1.0M | |
| Female 1.tif | 2017-09-15 07:54 | 2.0M | |
| Female 2.tif | 2017-09-15 07:54 | 2.0M | |
| Female 3.tif | 2017-09-15 07:54 | 2.0M | |
| Frank Motley.tif | 2017-09-15 07:54 | 1.9M | |
| Frank Motley 2.tif | 2017-09-15 07:54 | 1.0M | |
| Fritsch and Winship.tif | 2017-09-15 07:54 | 3.1M | |
| George Rickerson.tif | 2017-09-15 07:54 | 2.0M | |
| Gov Docs and Periodi..> | 2017-09-15 07:54 | 3.2M | |
| Grace Phillipson.tif | 2017-09-15 07:54 | 2.0M | |
| Graduation--Right On..> | 2017-09-15 07:54 | 1.9M | |
| Hinkle Brown Anderse..> | 2017-09-15 07:54 | 4.0M | |
| Jackie Trimble.tif | 2017-09-15 07:54 | 2.0M | |
| Jane Fisher.tif | 2017-09-15 07:54 | 3.1M | |
| Jane Fisher 2.tif | 2017-09-15 07:54 | 1.0M | |
| Joan Allard.tif | 2017-09-15 07:54 | 1.9M | |
| John Crosby.tif | 2017-09-15 07:54 | 1.9M | |
| John Crosby 2.tif | 2017-09-15 07:54 | 1.0M | |
| Kackie Trimble 2.tif | 2017-09-15 07:54 | 1.9M | |
| Karen Kamara.tif | 2017-09-15 07:54 | 2.0M | |
| Kathryn Ford.tif | 2017-09-15 07:54 | 1.0M | |
| Ken Wilhelm.tif | 2017-09-15 07:54 | 1.3M | |
| Ken Wilhelm 2.tif | 2017-09-15 07:54 | 1.0M | |
| Kevin Bunce.tif | 2017-09-15 07:54 | 1.0M | |
| Kimbro-Motley-Allard..> | 2017-09-15 07:54 | 3.9M | |
| LeCompte-Winship.tif | 2017-09-15 07:54 | 3.9M | |
| Libby Beck.tif | 2017-09-15 07:54 | 2.0M | |
| Library.tif | 2017-09-15 07:54 | 1.9M | |
| Library Adminstratio..> | 2017-09-15 07:54 | 3.3M | |
| Library Opening Jan. 72 | 2017-09-15 07:54 | 1.9M | |
| Library Opening Jan ..> | 2017-09-15 07:54 | 1.9M | |
| Lin Crowley.tif | 2017-09-15 07:54 | 1.0M | |
| Linda Fraidenberg.tif | 2017-09-15 07:54 | 1.0M | |
| Lorri Trimble.tif | 2017-09-15 07:54 | 1.0M | |
| Lucy Enriquez.tif | 2017-09-15 07:54 | 2.0M | |
| Malcolm Stilson.tif | 2017-09-15 07:54 | 2.0M | |
| Male 1.tif | 2017-09-15 07:54 | 2.0M | |
| Male 2.tif | 2017-09-15 07:54 | 1.4M | |
| Male 3.tif | 2017-09-15 07:54 | 1.4M | |
| Malpina Chan.tif | 2017-09-15 07:54 | 1.0M | |
| Marge Brown.tif | 2017-09-15 07:54 | 1.0M | |
| MaryBeth Berney.tif | 2017-09-15 07:54 | 2.3M | |
| Mary Finch.tif | 2017-09-15 07:54 | 1.0M | |
| Media Loan 1988.tif | 2017-09-15 07:54 | 3.2M | |
| Media Loan Staff.tif | 2017-09-15 07:54 | 3.9M | |
| Media Master Control..> | 2017-09-15 07:54 | 3.4M | |
| Merry Valentine's Da..> | 2017-09-15 07:54 | 2.0M | |
| Miko Francis.tif | 2017-09-15 07:54 | 1.0M | |
| Mindy Muzatko.tif | 2017-09-15 07:54 | 467K | |
| Pedersen Thurston Ki..> | 2017-09-15 07:54 | 3.9M | |
| Peter Randlette.tif | 2017-09-15 07:54 | 1.0M | |
| Phoebe Walker.tif | 2017-09-15 07:54 | 1.6M | |
| Photo Services 1980.tif | 2017-09-15 07:54 | 3.3M | |
| Photo Services Staff..> | 2017-09-15 07:54 | 3.9M | |
| Randolph Stilson.tif | 2017-09-15 07:54 | 1.0M | |
| Rich Edwards and Co.tif | 2017-09-15 07:54 | 3.9M | |
| Robert Haft.tif | 2017-09-15 07:54 | 3.9M | |
| Robert King and Vic ..> | 2017-09-15 07:54 | 1.9M | |
| Ron Clarke.tif | 2017-09-15 07:54 | 1.9M | |
| Russell Megiveron.tif | 2017-09-15 07:54 | 4.0M | |
| Sara Huntington.tif | 2017-09-15 07:54 | 1.0M | |
| Shelley Swelland.tif | 2017-09-15 07:54 | 1.0M | |
| Steve Davis.tif | 2017-09-15 07:54 | 1.0M | |
| Steve Metcalf.tif | 2017-09-15 07:54 | 1.0M | |
| Susan Johns.tif | 2017-09-15 07:54 | 1.0M | |
| Swelland-Gerheim-She..> | 2017-09-15 07:54 | 3.9M | |
| Technical Services A..> | 2017-09-15 07:54 | 3.9M | |
| Technical Services P..> | 2017-09-15 07:54 | 3.2M | |
| Terry Hubbard.tif | 2017-09-15 07:54 | 2.0M | |
| The Perishable Press..> | 2017-09-15 07:54 | 1.9M | |
| The Perishable Press..> | 2017-09-15 07:54 | 1.9M | |
| The Perishable Press..> | 2017-09-15 07:54 | 1.9M | |
| The Perishable Press..> | 2017-09-15 07:54 | 1.9M | |
| The Perishable Press..> | 2017-09-15 07:54 | 1.9M | |
| The Perishable Press..> | 2017-09-15 07:54 | 1.9M | |
| The Perishable Press..> | 2017-09-15 07:54 | 1.9M | |
| The Perishable Press..> | 2017-09-15 07:54 | 1.9M | |
| The Perishable Press..> | 2017-09-15 07:54 | 1.9M | |
| The Perishable Press..> | 2017-09-15 07:54 | 1.9M | |
| The Perishable Press..> | 2017-09-15 07:54 | 1.9M | |
| The Perishable Press..> | 2017-09-15 07:54 | 1.9M | |
| Ther Perishable Pres..> | 2017-09-15 07:54 | 1.9M | |
| Tim Markus.tif | 2017-09-15 07:54 | 1.0M | |
| Tim Moffat 1.tif | 2017-09-15 07:54 | 1.2M | |
| Tim Moffat 2.tif | 2017-09-15 07:54 | 1.3M | |
| Tom LeCompt.tif | 2017-09-15 07:54 | 1.0M | |
| Tyler and Winship.tif | 2017-09-15 07:54 | 3.7M | |
| Vic Buff.tif | 2017-09-15 07:54 | 2.0M | |
| Video Set.tif | 2017-09-15 07:54 | 3.9M | |
| Video Set 2.tif | 2017-09-15 07:54 | 3.9M | |
| WA State Library Sta..> | 2017-09-15 07:54 | 1.9M | |
| Wanda Schroeder.tif | 2017-09-15 07:54 | 2.0M | |
| Warber-Smith-Thursto..> | 2017-09-15 07:54 | 3.9M | |
| Wendy Ortiz.tif | 2017-09-15 07:54 | 441K | |
| Woody Hirzel.tif | 2017-09-15 07:54 | 1.4M | |
| Woody Hirzel 2.tif | 2017-09-15 07:54 | 2.0M | |
| Wyatt Cates.tif | 2017-09-15 07:54 | 3.2M | |
| Wyatt Cates 2.tif | 2017-09-15 07:54 | 4.0M | |
| Wyatt Cates 3.tif | 2017-09-15 07:54 | 1.9M | |
| Wyatt Cates 4.tif | 2017-09-15 07:54 | 2.0M | |
| Wyatt Cates and Marg..> | 2017-09-15 07:54 | 3.9M | |
| YHPARGOPYT.tif | 2017-09-15 07:54 | 1.9M | |
| hpothb07.dat | 2017-09-15 07:54 | 27K | |
| hpothb07.tif | 2017-09-15 07:54 | 2.0M | |